micheniquedavis1616 micheniquedavis1616

17-12-2019
Mathematics

contestada

(5x+4)(5x-4) using FOIL method, multiply the terms in the binomials

Respuesta :

PollyP52 PollyP52

17-12-2019

Answer:

25x^2 - 16.

Step-by-step explanation:

(5x+4)(5x-4)

F = 5X*5X = 25X^2

O = 5x * - 4 = -20x

I = 4 + 5x = 20x

L = +4 * -4 = -16

So its

25x^2 - 20x + 20x - 16

= 25x^2 - 16.

Answer Link

Otras preguntas

АУ X a. What are the independent and dependent quantities? Independent: Dependent: b. Libel the independent and dependent quantities on the correct axis on the

3.5.3 Test (CST): Functions Does this graph show a function? Explain how you know. 66 PE -2 E C N 6 8 A. No; there are y-values that have more than one x-value.

According to the video, usually the final short-list of potential nominees get to sit and meet with the president. How many nominees usually make it this far?.

Determine which solution is correct for solving - y = 6 using reciprocals. 5 7 Y=6 5 7 y 5 30 7 5 - (윽) (6) y = ○ 5 7y=6 5 y-23 y= 5 -6- 7 5 5 74= 6 7 5 y = 5 4

In most local governments, the mayor and council members have national elections, and ✓terms. Local elections are usually held separately from ✓ people usually

why did literacy rate increase during the late 1800s? A. there were increase in immigrants B. people wanted to read the newspaper for leisure. C uion workersw b

nswer Draw and name the following compound CH3CHCHCH(CH3)CH(CH3)CH2CH2CH3 CECEC-

Please help me how law of motion applied in tug of war game need step by step explanation

Questions in picture

Answer for (4)(4+2^2-4) ???