christopherjones59 christopherjones59

18-05-2021
Mathematics

contestada

How many quarts are there in 10 1⁄2 gallons?
Write an equation to show your work
plz answer fast it is a test!

Respuesta :

zaniyahbrooke zaniyahbrooke

18-05-2021

Answer:

42 quarts

Step-by-step explanation:

There are 4 quarts in one gallon, so you'd just multiply.

Answer Link

Otras preguntas

What separated early Southeast Asians?

During the classical Greek era what did the images on funerary monuments represent

Explain how a firm values the contribution of workers to its profitability. would a profit-maximizing competitive firm ever stop increasing employment as long a

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

what is the y intercept of y=2x+3

Fiona isn't really sure what to believe about indian immigrants to england, but she knows what her parents and friends think. because she is concerned with bein

Answer Please will rate and more!!!!!!!!!!!!!!!!!!!!!!!!!!

Chapters 13-15 review 1. which developments most directly fostered the evolution of the political parties and the sectionalism by the mid-19 th century? 2. what

Do you believe racial prejudice among british settlers in the chesapeake led them to enslave africans? or did the unfree condition of the first africans to arri

Which solution has the greatest percent ionization? (a) 0.010 m formic acid (ka = 1.8  10–4 ) (b) 0.10 m formic acid (ka = 1.8  10–4 ) (c) 0.010 m acetic acid