mijahdoug mijahdoug

20-02-2017
Geography

contestada

why do large bodies of water cause local winds to shift?

Respuesta :

LeBellé LeBellé

20-02-2017

Large bodies of water heat up more slowly during the day and cool off more slowly at night then nearby land

Answer Link

Otras preguntas

c,est quoi une litterature courtoise

Is CH3CH2CH(CH3CH2)CH(CH3)CH2(CH3) 3-ethyl-4,5-dimethylpentane ?

One large jar and five small jars can hold 26 ounces of jam. One large jar minus one small jar can hold 2 ounces of jam. Set up the coefficient matrix, variabl

the measure θ of an angle in standard position is given. Find the exact values of cos and sin for each angle measure.

5. Individual Problems 17-5 You are offered the following gamble based on coin flips. If the first heads occurs on the first flip, you get $2. If the first head

of the equilibrium constant for the reaction A28C572 0 has a value of 4.0, what is tihe value of the equilibriums constant for the reaction 20-502A-48 at the sa

ap precalculus unit 3 mcq progress check answers

Base your answer to the following question on on the information below. A solution is made by completely dissolving 90. grams of KNO3(s) in 100. grams of water

17 kilogram of aluminum was produced from 51 kilogram of aluminum oxide by electrolysis what was the percentage yield

Who authored the earliest known written code of laws? a) abraham b) god c) pharaoh d) hammurabi